Systematic / IUPAC Name: 2-Ethoxypyridine-4-carboxylic acid
ID: Reference13827
Other Names: AA-4301
Formula: C8H9NO3
Class: Endogenous Metabolites
2-Ethoxyisonicotinic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 305 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/12/2026 3:16:30 PM |
| InChI | InChI=1S/C8H9NO3/c1-2-12-7-5-6(8(10)11)3-4-9-7/h3-5H,2H2,1H3,(H,10,11) |
| InChI Key | ZGGJYLYCHXPTRY-UHFFFAOYSA-N |
| Canonical SMILES | CCOc1cc(C(=O)O)ccn1 |
| CAS | |
| Splash | |
| Other Names | AA-4301 |