Systematic / IUPAC Name: 6-Methoxypyridine-3-carboxylic acid
ID: Reference13828
Other Names: AA-4302
Formula: C7H7NO3
Class: Endogenous Metabolites
6-Methoxynicotinic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 170 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/12/2026 3:17:13 PM |
| InChI | InChI=1S/C7H7NO3/c1-11-6-3-2-5(4-8-6)7(9)10/h2-4H,1H3,(H,9,10) |
| InChI Key | NVDJVEQITUWZDT-UHFFFAOYSA-N |
| Canonical SMILES | COc1ccc(C(=O)O)cn1 |
| CAS | |
| Splash | |
| Other Names | AA-4302 |
| ChEBI | CHEBI:89900 |
| HMDb | HMDB0059749; HMDB0059749 |
| ChemSpider | 515062 |
| PubChem | 592499; 592499 |