Systematic / IUPAC Name: 1,3-Dimethylpyrimidine-2,4-dione
ID: Reference13839
Other Names: AA-3817
Formula: C6H8N2O2
Class: Endogenous Metabolites
1,3-Dimethyluracil mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 160 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/25/2026 10:57:25 AM |
| InChI | InChI=1S/C6H8N2O2/c1-7-4-3-5(9)8(2)6(7)10/h3-4H,1-2H3 |
| InChI Key | JSDBKAHWADVXFU-UHFFFAOYSA-N |
| Canonical SMILES | Cn1ccc(=O)n(C)c1=O |
| CAS | |
| Splash | |
| Other Names | AA-3817 |
| ChemSpider | 63310 |
| PubChem | 70122; 70122 |
| HMDb | HMDB0002144 |
| ChEBI | CHEBI:74763 |
| ChEMBL | CHEMBL11470 |