Systematic / IUPAC Name: 5,6-Dihydroxy-1H-indole-2-carboxylic acid
ID: Reference13843
Other Names:
5,6-Dihydroxy-2-indolecarboxylic acid;
AA-4310
Formula: C9H7NO4
Class: Endogenous Metabolites
5,6-Dihydroxyindole-2-carboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 433 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/27/2026 9:34:47 PM |
| InChI | InChI=1S/C9H7NO4/c11-7-2-4-1-6(9(13)14)10-5(4)3-8(7)12/h1-3,10-12H,(H,13,14) |
| InChI Key | YFTGOBNOJKXZJC-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)c1cc2cc(O)c(O)cc2[nH]1 |
| CAS | |
| Splash | |
| Other Names |
5,6-Dihydroxy-2-indolecarboxylic acid; AA-4310 |
| HMDb | HMDB0001253 |
| PubChem | 119405 |
| ChEBI | CHEBI:2003 |
| ChemSpider | 106648 |
| ChEMBL | CHEMBL267855 |
| Wikipedia | DHICA |
| KEGG | C04185 |