Systematic / IUPAC Name: 2-Hydroxy-2-(4-methoxyphenyl)acetic acid
ID: Reference13846
Other Names: AA-4325
Formula: C9H10O4
Class: Endogenous Metabolites
4-Methoxymandelic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 335 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/27/2026 9:41:53 PM |
| InChI | InChI=1S/C9H10O4/c1-13-7-4-2-6(3-5-7)8(10)9(11)12/h2-5,8,10H,1H3,(H,11,12) |
| InChI Key | ITECRQOOEQWFPE-UHFFFAOYSA-N |
| Canonical SMILES | COc1ccc(C(O)C(=O)O)cc1 |
| CAS | |
| Splash | |
| Other Names | AA-4325 |
| ChemSpider | 100467 |
| ChEMBL | CHEMBL58565 |
| PubChem | 112056; 112056 |
| HMDb | HMDB0140294 |