Systematic / IUPAC Name: 2,4-Dioxo-1H-pyrimidine-5-carbaldehyde
ID: Reference13849
Other Names: AA-4358
Formula: C5H4N2O3
Class: Endogenous Metabolites
5-Formyluracil mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 300 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/2/2026 12:34:52 PM |
| InChI | InChI=1S/C5H4N2O3/c8-2-3-1-6-5(10)7-4(3)9/h1-2H,(H2,6,7,9,10) |
| InChI Key | OHAMXGZMZZWRCA-UHFFFAOYSA-N |
| Canonical SMILES | O=Cc1c[nH]c(=O)[nH]c1=O |
| CAS | |
| Splash | |
| Other Names | AA-4358 |
| KEGG | C17206 |
| PubChem | 304590; 304590 |
| Wikipedia | 5-Formyluracil |
| ChemSpider | 269368 |
| ChEBI | CHEBI:80961 |