Systematic / IUPAC Name: 4-Isopropenyl-1-cyclohexene-1-carboxylic acid
ID: Reference1385
Other Names:
4-(Prop-1-en-2-yl)cyclohex-1-ene-1-carboxylic acid;
4-(1-Methylethenyl)-1-cyclohexene-1-carboxylic acid;
(S)-(-)-4-Isopropenyl-1-cyclohexene-1-carboxylic acid;
1-Cyclohexene-1-carboxylic acid, 4-(1-methylethenyl)-
Formula: C10H14O2
Class: Endogenous Metabolites
Perillic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 150 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/4/2014 7:39:27 AM |
| InChI | InChI=1S/C10H14O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h5,8H,1,3-4,6H2,2H3,(H,11,12) |
| InChI Key | CDSMSBUVCWHORP-UHFFFAOYSA-N |
| Canonical SMILES | CC(=C)C1CCC(=CC1)C(=O)O |
| CAS | 7694453 |
| Splash | |
| Other Names |
4-(Prop-1-en-2-yl)cyclohex-1-ene-1-carboxylic acid; 4-(1-Methylethenyl)-1-cyclohexene-1-carboxylic acid; (S)-(-)-4-Isopropenyl-1-cyclohexene-1-carboxylic acid; 1-Cyclohexene-1-carboxylic acid, 4-(1-methylethenyl)- |
| KEGG | C11924 |
| HMDb | HMDB04586 |
| ChEBI | CHEBI:36999 |
| Wikipedia | Perillasäure (DE) |
| ChEMBL | CHEMBL1373981 |
| ChemIDPlus | 007694453 |
| ChemSpider | 1218 |
| PubChem | 1256 |