Systematic / IUPAC Name: 1,3-Dimethoxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzene
ID: Reference13850
Other Names: AA-4359
Formula: C17H18O3
Class: Endogenous Metabolites
3,4',5-Trimethoxystilbene mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 652 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/2/2026 12:33:51 PM |
| InChI | InChI=1S/C17H18O3/c1-18-15-8-6-13(7-9-15)4-5-14-10-16(19-2)12-17(11-14)20-3/h4-12H,1-3H3/b5-4+ |
| InChI Key | GDHNBPHYVRHYCC-SNAWJCMRSA-N |
| Canonical SMILES | COc1ccc(/C=C/c2cc(OC)cc(OC)c2)cc1 |
| CAS | |
| Splash | |
| Other Names | AA-4359 |
| ChemSpider | CAM-DRS-HFS-106; 4534357 |
| ChEMBL | CHEMBL296411 |
| PubChem | 5388063; 5388063 |