Systematic / IUPAC Name: 3-(Dimethylamino)propanoic acid
ID: Reference13854
Other Names: AA-4135
Formula: C5H11NO2
Class: Endogenous Metabolites
N,N-Dimethyl-β-alanine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 220 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/1/2026 10:04:08 AM |
| InChI | InChI=1S/C5H11NO2/c1-6(2)4-3-5(7)8/h3-4H2,1-2H3,(H,7,8) |
| InChI Key | JMOXSQYGVIXBBZ-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)CCC(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-4135 |
| ChEBI | CHEBI:138668 |
| ChemSpider | 209512 |
| PubChem | 25201408 |