Systematic / IUPAC Name: 3-(Furan-2-yl)propanoic acid
ID: Reference13855
Other Names: AA-4134
Formula: C7H8O3
Class: Endogenous Metabolites
2-Furanpropionic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 285 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/2/2026 12:39:41 PM |
| InChI | InChI=1S/C7H8O3/c8-7(9)4-3-6-2-1-5-10-6/h1-2,5H,3-4H2,(H,8,9) |
| InChI Key | XLTJXJJMUFDQEZ-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)CCc1ccco1 |
| CAS | |
| Splash | |
| Other Names | AA-4134 |