Systematic / IUPAC Name: Furan-2,5-dicarboxylic acid
ID: Reference13857
Other Names: AA-4181
Formula: C6H4O5
Class: Endogenous Metabolites
2,5-Furandicarboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 295 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/7/2026 3:31:43 PM |
| InChI | InChI=1S/C6H4O5/c7-5(8)3-1-2-4(11-3)6(9)10/h1-2H,(H,7,8)(H,9,10) |
| InChI Key | CHTHALBTIRVDBM-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)c1ccc(C(=O)O)o1 |
| CAS | |
| Splash | |
| Other Names | AA-4181 |
| KEGG | C20450 |
| PubChem | 76720; 76720 |
| ChemSpider | 69178 |
| Wikipedia | 2,5-Furandicarboxylic acid |
| HMDb | HMDB0004812; HMDB0004812; HMDB0004812 |
| ChEBI | CHEBI:84212 |