Systematic / IUPAC Name: 1,3,7,9-Tetramethylpurine-2,6,8-trione
ID: Reference13861
Other Names: AA-4263
Formula: C9H12N4O3
Class: Endogenous Metabolites
Theacrine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 934 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/8/2026 1:47:47 PM |
| InChI | InChI=1S/C9H12N4O3/c1-10-5-6(11(2)8(10)15)12(3)9(16)13(4)7(5)14/h1-4H3 |
| InChI Key | QGDOQULISIQFHQ-UHFFFAOYSA-N |
| Canonical SMILES | Cn1c(=O)c2c(n(C)c1=O)n(C)c(=O)n2C |
| CAS | |
| Splash | |
| Other Names | AA-4263 |
| HMDb | HMDB0004328 |
| PubChem | 75324 |
| ChEMBL | CHEMBL143715 |
| ChemSpider | 67862 |
| ChEBI | CHEBI:139388 |
| Wikipedia | Theacrine |