Systematic / IUPAC Name: 4-Amino-1H-imidazole-5-carboxamide
ID: Reference13864
Other Names: AA-2702
Formula: C9H7NO2
Class: Endogenous Metabolites Natural Toxins
Quinoline-4,8-diol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 35 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/27/2026 12:06:10 PM |
| InChI | InChI=1S/C9H7NO2/c11-7-4-5-10-9-6(7)2-1-3-8(9)12/h1-5,12H,(H,10,11) |
| InChI Key | PYELIMVFIITPER-UHFFFAOYSA-N |
| Canonical SMILES | O=c1cc[nH]c2c(O)cccc12 |
| CAS | |
| Splash | |
| Other Names | AA-2702 |
| HMDb | HMDB0060289; HMDB60289 |
| ChemSpider | 389608 |
| PubChem | 440737 |
| ChEBI | CHEBI:28883 |
| KEGG | C05637 |