Systematic / IUPAC Name: 4-Amino-1H-imidazole-5-carboxamide
ID: Reference13864
Other Names: AA-4191
Formula: C4H6N4O
Class: Endogenous Metabolites
5-Aminoimidazole-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 514 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/8/2026 8:17:41 AM |
| InChI | InChI=1S/C4H6N4O/c5-3-2(4(6)9)7-1-8-3/h1H,5H2,(H2,6,9)(H,7,8) |
| InChI Key | DVNYTAVYBRSTGK-UHFFFAOYSA-N |
| Canonical SMILES | NC(=O)c1nc[nH]c1N |
| CAS | |
| Splash | |
| Other Names | AA-4191 |
| HMDb | HMDB0003192; HMDB0003192; HMDB0003192 |
| ChemSpider | 9298 |
| PubChem | 9679; 9679 |
| ChEBI | CHEBI:2030 |
| KEGG | C04051 |
| ChEMBL | CHEMBL1610 |