Systematic / IUPAC Name: (2R)-2-Amino-3-methoxypropanoic acid
ID: Reference13866
Other Names: AA-4149
Formula: C4H9NO3
Class: Endogenous Metabolites
O-Methyl-D-serine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 160 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/8/2026 11:23:50 AM |
| InChI | InChI=1S/C4H9NO3/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m1/s1 |
| InChI Key | KNTFCRCCPLEUQZ-GSVOUGTGSA-N |
| Canonical SMILES | COC[C@@H](N)C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-4149 |
| ChemSpider | 79613 |
| ChEMBL | CHEMBL549290 |
| PubChem | 88251 |