Systematic / IUPAC Name: 4-[(E)-2-(3,5-Dimethoxyphenyl)ethenyl]phenol
ID: Reference13873
Other Names:
Pterostilbene;
AA-4153
Formula: C16H16O3
Class: Endogenous Metabolites
trans-Pterostilbene mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3013 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/15/2026 1:43:03 PM |
| InChI | InChI=1S/C16H16O3/c1-18-15-9-13(10-16(11-15)19-2)4-3-12-5-7-14(17)8-6-12/h3-11,17H,1-2H3/b4-3+ |
| InChI Key | VLEUZFDZJKSGMX-ONEGZZNKSA-N |
| Canonical SMILES | COc1cc(/C=C/c2ccc(O)cc2)cc(OC)c1 |
| CAS | |
| Splash | |
| Other Names |
Pterostilbene; AA-4153 |
| LipidsMAPs | LMPK13090015 |
| HMDb | HMDB0130987 |
| Wikipedia | Pterostilbene |
| PubChem | 5281727; 5281727 |
| KEGG | C10287 |
| ChEBI | CHEBI:8630 |
| ChEMBL | CHEMBL83527 |
| ChemSpider | 4445042 |