Systematic / IUPAC Name: (2S)-2-Amino-5-[(N'-methylcarbamimidoyl)amino]pentanoic acid
ID: Reference13874
Other Names: AA-4203
Formula: C7H16N4O2
Class: Endogenous Metabolites
Tilarginine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1355 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/15/2026 1:48:21 PM |
| InChI | InChI=1S/C7H16N4O2/c1-10-7(9)11-4-2-3-5(8)6(12)13/h5H,2-4,8H2,1H3,(H,12,13)(H3,9,10,11)/t5-/m0/s1 |
| InChI Key | NTNWOCRCBQPEKQ-YFKPBYRVSA-N |
| Canonical SMILES | CNC(=N)NCCC[C@H](N)C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-4203 |
| ChEMBL | CHEMBL256147 |
| DrugBank | DB11815 |
| HMDb | HMDB0029416 |
| KEGG | C03884 |
| PubChem | 46906075 |
| ChemSpider | 117259 |
| ChEBI | CHEBI:28229 |