Systematic / IUPAC Name: 5-(Hydroxymethyl)benzene-1,3-diol
ID: Reference13876
Other Names: AA-4461
Formula: C7H8O3
Class: Endogenous Metabolites
3,5-Dihydroxybenzyl alcohol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 343 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/17/2026 8:04:19 AM |
| InChI | InChI=1S/C7H8O3/c8-4-5-1-6(9)3-7(10)2-5/h1-3,8-10H,4H2 |
| InChI Key | NGYYFWGABVVEPL-UHFFFAOYSA-N |
| Canonical SMILES | OCc1cc(O)cc(O)c1 |
| CAS | |
| Splash | |
| Other Names | AA-4461 |
| ChemSpider | 31899 |
| PubChem | 34661; 34661 |
| ChEMBL | CHEMBL4076614 |