Systematic / IUPAC Name: (5R)-5-Methyl-2-propan-2-ylidenecyclohexan-1-one
ID: Reference13885
Other Names:
(+)-Pulegone;
AA-4699
Formula: C10H16O
Class: Endogenous Metabolites
(R)-(+)-Pulegone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 815 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/23/2026 6:51:28 PM |
| InChI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h8H,4-6H2,1-3H3/t8-/m1/s1 |
| InChI Key | NZGWDASTMWDZIW-MRVPVSSYSA-N |
| Canonical SMILES | CC(C)=C1CC[C@@H](C)CC1=O |
| CAS | |
| Splash | |
| Other Names |
(+)-Pulegone; AA-4699 |
| KEGG | C09893 |
| ChEBI | CHEBI:35596 |
| PubChem | 442495; 442495 |
| ChEMBL | CHEMBL2924219 |
| HMDb | HMDB61794 |
| ChemSpider | 390923 |
| Wikipedia | Pulegone |
| LipidsMAPs | LMPR0102090025 |