Systematic / IUPAC Name: 3-Methoxypropanoic acid
ID: Reference13892
Other Names: AA-4727
Formula: C4H8O3
Class: Endogenous Metabolites
3-Methoxypropionic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 105 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/30/2026 8:22:13 AM |
| InChI | InChI=1S/C4H8O3/c1-7-3-2-4(5)6/h2-3H2,1H3,(H,5,6) |
| InChI Key | YSIKHBWUBSFBRZ-UHFFFAOYSA-N |
| Canonical SMILES | COCCC(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-4727 |
| ChEMBL | CHEMBL3358702 |
| ChemSpider | 118510 |
| PubChem | 134442; 134442 |