Systematic / IUPAC Name: 2-Phenylethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate
ID: Reference13895
Other Names: AA-4396
Formula: C17H16O4
Class: Endogenous Metabolites
Caffeic acid phenethyl ester mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 575 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/5/2026 8:03:00 AM |
| InChI | InChI=1S/C17H16O4/c18-15-8-6-14(12-16(15)19)7-9-17(20)21-11-10-13-4-2-1-3-5-13/h1-9,12,18-19H,10-11H2/b9-7+ |
| InChI Key | SWUARLUWKZWEBQ-VQHVLOKHSA-N |
| Canonical SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OCCc1ccccc1 |
| CAS | |
| Splash | |
| Other Names | AA-4396 |
| ChEBI | CHEBI:8062 |
| ChEMBL | CHEMBL319244 |
| Wikipedia | Caffeic acid phenethyl ester |
| KEGG | C10484 |
| ChemSpider | 4445100 |
| PubChem | 5281787; 5281787 |