Systematic / IUPAC Name: (2R,4S)-Pentane-1,2,3,4,5-pentol
ID: Reference13896
Other Names: AA-4397
Formula: C5H12O5
Class: Endogenous Metabolites
Ribitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 884 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/5/2026 7:52:57 AM |
| InChI | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5? |
| InChI Key | HEBKCHPVOIAQTA-NGQZWQHPSA-N |
| Canonical SMILES | OC[C@@H](O)C(O)[C@@H](O)CO |
| CAS | |
| Splash | |
| Other Names | AA-4397 |
| ChEMBL | CHEMBL1865120 |
| PubChem | 6912 |
| HMDb | HMDB0002917; HMDB0002917; HMDB0002917; HMDB0002917; HMDB0002917 |
| ChemSpider | 21391692 |