Systematic / IUPAC Name: Methyl 4-aminobutanoate
ID: Reference13897
Other Names: AA-4400
Formula: C5H11NO2
Class: Endogenous Metabolites
Methyl 4-aminobutanoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 104 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/5/2026 7:50:27 AM |
| InChI | InChI=1S/C5H11NO2/c1-8-5(7)3-2-4-6/h2-4,6H2,1H3 |
| InChI Key | KVQGGLZHHFGHPU-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)CCCN |
| CAS | |
| Splash | |
| Other Names | AA-4400 |
| ChemSpider | 17580 |
| ChEBI | CHEBI:42955 |
| PubChem | 18614 |