Systematic / IUPAC Name: 2-(4-Methylphenyl)propanoic acid
ID: Reference13898
Other Names:
p-Methylhydratropic acid;
AA-4474
Formula: C10H12O2
Class: Endogenous Metabolites
2-(4-Methylphenyl)propionic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 60 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/18/2026 10:22:42 AM |
| InChI | InChI=1S/C10H12O2/c1-7-3-5-9(6-4-7)8(2)10(11)12/h3-6,8H,1-2H3,(H,11,12) |
| InChI Key | KDYOFXPLHVSIHS-UHFFFAOYSA-N |
| Canonical SMILES | Cc1ccc(C(C)C(=O)O)cc1 |
| CAS | |
| Splash | |
| Other Names |
p-Methylhydratropic acid; AA-4474 |
| ChemSpider | 132972 |
| ChEMBL | CHEMBL190275 |
| PubChem | 150866; 150866 |