Systematic / IUPAC Name: (2R)-2-Aminopentanoic acid
ID: Reference13899
Other Names: AA-4478
Formula: C5H11NO2
Class: Endogenous Metabolites
D-Norvaline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 178 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/18/2026 8:41:53 AM |
| InChI | InChI=1S/C5H11NO2/c1-2-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m1/s1 |
| InChI Key | SNDPXSYFESPGGJ-SCSAIBSYSA-N |
| Canonical SMILES | CCC[C@@H](N)C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-4478 |
| PubChem | 6950515 |
| ChemSpider | 388660 |
| ChEBI | CHEBI:28804 |
| HMDb | HMDB0013716; HMDB0013716; HMDB0013716 |
| ChEMBL | CHEMBL1916081 |
| KEGG | C01799 |