Systematic / IUPAC Name: Octan-2-one
ID: Reference13903
Other Names: AA-4683
Formula: C8H16O
Class: Endogenous Metabolites
2-Octanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 80 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/11/2026 9:26:21 AM |
| InChI | InChI=1S/C8H16O/c1-3-4-5-6-7-8(2)9/h3-7H2,1-2H3 |
| InChI Key | ZPVFWPFBNIEHGJ-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCC(C)=O |
| CAS | |
| Splash | |
| Other Names | AA-4683 |
| HMDb | HMDB0031294; HMDB31294 |
| PubChem | 8093; 8093 |
| ChemSpider | 7802 |
| ChEMBL | CHEMBL18549 |
| ChEBI | CHEBI:87434 |
| LipidsMAPs | LMFA12000054 |