Systematic / IUPAC Name: (3R,4R,5R,6S)-6-Methyloxane-2,3,4,5-tetrol
ID: Reference13905
Other Names: AA-4491
Formula: C6H12O5
Class: Endogenous Metabolites
L-(+)-Rhamnose mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 740 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/18/2026 8:37:23 AM |
| InChI | InChI=1S/C6H12O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-10H,1H3/t2-,3-,4+,5+,6?/m0/s1 |
| InChI Key | SHZGCJCMOBCMKK-JFNONXLTSA-N |
| Canonical SMILES | C[C@@H]1OC(O)[C@H](O)[C@H](O)[C@H]1O |
| CAS | |
| Splash | |
| Other Names | AA-4491 |
| PubChem | 25310 |
| HMDb | HMDB0000174; HMDB0000174; HMDB00849; HMDB0000174 |
| KEGG | C00507 |
| ChemSpider | 23642 |
| ChEMBL | CHEMBL5308434 |
| ChEBI | CHEBI:62346 |