Systematic / IUPAC Name: 3-Hydroxy-2-phenylpropanoic acid
ID: Reference13907
Other Names: AA-4411
Formula: C9H10O3
Class: Endogenous Metabolites
Tropic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 315 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/18/2026 7:46:20 AM |
| InChI | InChI=1S/C9H10O3/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12) |
| InChI Key | JACRWUWPXAESPB-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)C(CO)c1ccccc1 |
| CAS | |
| Splash | |
| Other Names | AA-4411 |
| Wikipedia | Tropic acid |
| PubChem | 10726; 10726 |
| KEGG | C01456 |
| HMDb | HMDB62590 |
| ChemSpider | More details; 10274 |
| ChEBI | CHEBI:30765 |