Systematic / IUPAC Name: 3-(2-Methylphenyl)propanoic acid
ID: Reference13911
Other Names:
3-o-Tolylpropanoic acid;
AA-4223
Formula: C10H12O2
Class: Endogenous Metabolites
2-Methylhydrocinnamic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 128 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/22/2026 9:41:54 AM |
| InChI | InChI=1S/C10H12O2/c1-8-4-2-3-5-9(8)6-7-10(11)12/h2-5H,6-7H2,1H3,(H,11,12) |
| InChI Key | JIRKNEAMPYVPTD-UHFFFAOYSA-N |
| Canonical SMILES | Cc1ccccc1CCC(=O)O |
| CAS | |
| Splash | |
| Other Names |
3-o-Tolylpropanoic acid; AA-4223 |
| PubChem | 30938; 30938 |
| ChEMBL | CHEMBL2252086 |
| ChemSpider | 28703 |