Systematic / IUPAC Name: 2-Oxo-2-phenylacetaldehyde
ID: Reference13913
Other Names: AA-4229
Formula: C8H6O2
Class: Endogenous Metabolites
Phenylglyoxal mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 775 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/22/2026 9:47:17 AM |
| InChI | InChI=1S/C8H6O2/c9-6-8(10)7-4-2-1-3-5-7/h1-6H |
| InChI Key | OJUGVDODNPJEEC-UHFFFAOYSA-N |
| Canonical SMILES | O=CC(=O)c1ccccc1 |
| CAS | |
| Splash | |
| Other Names | AA-4229 |
| PubChem | 14090; 14090 |
| HMDb | HMDB0061916 |
| ChEMBL | CHEMBL233632 |
| ChemSpider | CDF-DXK-LDF-46; 13470 |
| ChEBI | CHEBI:88868 |
| Wikipedia | Phenylglyoxal |