Systematic / IUPAC Name: 2-Methylheptanoic acid
ID: Reference13914
Other Names: AA-4532
Formula: C8H16O2
Class: Endogenous Metabolites
2-Methylheptanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 76 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/22/2026 10:10:43 AM |
| InChI | InChI=1S/C8H16O2/c1-3-4-5-6-7(2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10) |
| InChI Key | NKBWMBRPILTCRD-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCC(C)C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-4532 |
| HMDb | HMDB0031587 |
| ChemSpider | 13821 |
| LipidsMAPs | LMFA01020391 |
| ChEMBL | CHEMBL1789306 |
| PubChem | 14475; 14475 |