Systematic / IUPAC Name: Diethyl 2-methyl-3-oxobutanedioate
ID: Reference13915
Other Names:
Butanedioic acid, 2-methyl-3-oxo-, 1,4-diethyl ester;
AA-4541
Formula: C9H14O5
Class: Endogenous Metabolites
Diethyl oxalpropionate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 215 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/22/2026 10:17:55 AM |
| InChI | InChI=1S/C9H14O5/c1-4-13-8(11)6(3)7(10)9(12)14-5-2/h6H,4-5H2,1-3H3 |
| InChI Key | OQOCQBJWOCRPQY-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C(=O)C(C)C(=O)OCC |
| CAS | |
| Splash | |
| Other Names |
Butanedioic acid, 2-methyl-3-oxo-, 1,4-diethyl ester; AA-4541 |
| KEGG | C04067 |
| ChEBI | CHEBI:16879 |
| HMDb | HMDB0032306 |
| ChemSpider | 88226 |
| PubChem | 97750; 97750 |