Systematic / IUPAC Name: Phenyl acetate
ID: Reference13917
Other Names: AA-4543
Formula: C8H8O2
Class: Endogenous Metabolites
Phenyl acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 440 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/22/2026 10:23:36 AM |
| InChI | InChI=1S/C8H8O2/c1-7(9)10-8-5-3-2-4-6-8/h2-6H,1H3 |
| InChI Key | IPBVNPXQWQGGJP-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)Oc1ccccc1 |
| CAS | |
| Splash | |
| Other Names | AA-4543 |
| PubChem | 31229; 31229 |
| HMDb | HMDB40733 |
| KEGG | C15583 |
| ChEMBL | CHEMBL289559 |
| ChemSpider | 28969 |
| ChEBI | CHEBI:8082 |
| Wikipedia | Phenyl acetate |