Systematic / IUPAC Name: 6-Propyloxan-2-one
ID: Reference13918
Other Names: AA-4741
Formula: C8H14O2
Class: Endogenous Metabolites Personal Care Products/Cosmetics
δ-Octalactone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 75 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/22/2026 10:25:36 AM |
| InChI | InChI=1S/C8H14O2/c1-2-4-7-5-3-6-8(9)10-7/h7H,2-6H2,1H3 |
| InChI Key | FYTRVXSHONWYNE-UHFFFAOYSA-N |
| Canonical SMILES | CCCC1CCCC(=O)O1 |
| CAS | |
| Splash | |
| Other Names | AA-4741 |
| Wikipedia | delta-Octalactone |
| ChemSpider | 12252 |
| HMDb | HMDB0038310 |
| PubChem | 12777; 12777 |
| ChEMBL | CHEMBL3182050 |
| LipidsMAPs | LMFA07040017 |