Systematic / IUPAC Name: 2-Methyl-5-propan-2-ylphenol
ID: Reference13919
Other Names: AA-4749
Formula: C10H14O
Class: Endogenous Metabolites Natural Products/Medicines Pesticides/Herbicides Excipients/Additives/Colorants Personal Care Products/Cosmetics
Carvacrol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 100 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/22/2026 10:26:26 AM |
| InChI | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4-7,11H,1-3H3 |
| InChI Key | RECUKUPTGUEGMW-UHFFFAOYSA-N |
| Canonical SMILES | Cc1ccc(C(C)C)cc1O |
| CAS | |
| Splash | |
| Other Names | AA-4749 |
| HMDb | HMDB0035770; HMDB0035770 |
| ChEBI | CHEBI:3440 |
| LipidsMAPs | LMPR0102090017 |
| ChemSpider | More details; 21105867 |
| PubChem | 10364; 10364 |
| Wikipedia | Carvacrol |
| ChEMBL | CHEMBL281202 |
| KEGG | C09840 |