Systematic / IUPAC Name: Methyl (2R)-2-aminopropanoate
ID: Reference1392
Other Names:
Methyl D-alaninate;
D-Alanine, methyl ester
Formula: C4H9NO2
D-Alanine methyl ester mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 3:03:29 PM |
| InChI | InChI=1S/C4H9NO2/c1-3(5)4(6)7-2/h3H,5H2,1-2H3/t3-/m1/s1 |
| InChI Key | DWKPPFQULDPWHX-GSVOUGTGSA-N |
| Canonical SMILES | |
| CAS | 80325 |
| Splash | |
| Other Names |
Methyl D-alaninate; D-Alanine, methyl ester |