Systematic / IUPAC Name: Propane-1,2,3-triol
ID: Reference13921
Other Names: AA-4826
Formula: C3H8O3
Class: Therapeutics/Prescription Drugs Endogenous Metabolites Excipients/Additives/Colorants Personal Care Products/Cosmetics
Glycerol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 35 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/22/2026 10:27:44 AM |
| InChI | InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2 |
| InChI Key | PEDCQBHIVMGVHV-UHFFFAOYSA-N |
| Canonical SMILES | OCC(O)CO |
| CAS | |
| Splash | |
| Other Names | AA-4826 |
| PubChem | 753; 753 |
| ChEBI | CHEBI:17522 |
| ChEMBL | CHEMBL692 |
| KEGG | C00116 |
| Wikipedia | Glycerol |
| HMDb | HMDB0000131; HMDB0000131; HMDB0000131; HMDB0000131; HMDB0000131 |
| DrugBank | DB04077; DB04077 |
| ChemSpider | NovoLog Mix 70/30; More details; 733 |