Systematic / IUPAC Name: 2-Aminopropanedioic acid
ID: Reference13924
Other Names: AA-4416
Formula: C3H5NO4
Class: Endogenous Metabolites
Aminomalonic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 84 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/29/2026 8:35:54 AM |
| InChI | InChI=1S/C3H5NO4/c4-1(2(5)6)3(7)8/h1H,4H2,(H,5,6)(H,7,8) |
| InChI Key | JINBYESILADKFW-UHFFFAOYSA-N |
| Canonical SMILES | NC(C(=O)O)C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-4416 |
| DrugBank | DB02289; DB02289 |
| KEGG | C00872 |
| ChEBI | CHEBI:17475 |
| ChEMBL | CHEMBL1232731 |
| ChemSpider | 90998 |
| PubChem | 5245668 |
| HMDb | HMDB0001147; HMDB0001147 |