Systematic / IUPAC Name: (4R)-4-[(3R,6S,8S,9S,10R,13R,14S,17R)-3,6-Dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid
ID: Reference13927
Other Names:
3a,6a-Dihydroxy-5b-cholanoic acid;
a-Hyodeoxycholic acid;
Hyodesoxycholate;
(3α,6α)-3,6-Dihydroxycholan-24-oic acid;
AA-3676
Formula: C24H40O4
Class: Endogenous Metabolites
Hyodeoxycholic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 745 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/29/2026 7:49:43 AM |
| InChI | InChI=1S/C24H40O4/c1-14(4-7-22(27)28)17-5-6-18-16-13-21(26)20-12-15(25)8-10-24(20,3)19(16)9-11-23(17,18)2/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15-,16+,17-,18+,19+,20?,21+,23-,24-/m1/s1 |
| InChI Key | DGABKXLVXPYZII-CDONHWFASA-N |
| Canonical SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@H]2[C@@H]3C[C@H](O)C4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| CAS | |
| Splash | |
| Other Names |
3a,6a-Dihydroxy-5b-cholanoic acid; a-Hyodeoxycholic acid; Hyodesoxycholate; (3α,6α)-3,6-Dihydroxycholan-24-oic acid; AA-3676 |
| PubChem | 9963687; 9963687 |
| HMDb | HMDB0000733; HMDB0000733; HMDB0000733 |
| ChemSpider | 8139282 |