Systematic / IUPAC Name: 6-Hexyloxan-2-one
ID: Reference13929
Other Names: AA-4549
Formula: C11H20O2
Class: Endogenous Metabolites
δ-Undecalactone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1383 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/29/2026 8:52:11 AM |
| InChI | InChI=1S/C11H20O2/c1-2-3-4-5-7-10-8-6-9-11(12)13-10/h10H,2-9H2,1H3 |
| InChI Key | YZRXRLLRSPQHDK-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCC1CCCC(=O)O1 |
| CAS | |
| Splash | |
| Other Names | AA-4549 |
| ChemSpider | 55148 |
| HMDb | HMDB0036784 |
| ChEMBL | CHEMBL372447 |
| PubChem | 61204; 61204 |