Systematic / IUPAC Name: Octanedioic acid
ID: Reference1393
Other Names:
1,6-Hexanedicarboxylic acid;
Octane-1,8-dioic acid;
Octane-1,8-dioate;
1,6-Hexanedicarboxylate;
Cork acid
Formula: C8H14O4
Class: Endogenous Metabolites
Suberic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 208 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 3:02:41 PM |
| InChI | InChI=1S/C8H14O4/c9-7(10)5-3-1-2-4-6-8(11)12/h1-6H2,(H,9,10)(H,11,12) |
| InChI Key | TYFQFVWCELRYAO-UHFFFAOYSA-N |
| Canonical SMILES | C(CCCC(=O)O)CCC(=O)O |
| CAS | 505486 |
| Splash | |
| Other Names |
1,6-Hexanedicarboxylic acid; Octane-1,8-dioic acid; Octane-1,8-dioate; 1,6-Hexanedicarboxylate; Cork acid; Suberate |
| PubChem | 10457 |
| ChemSpider | 10025 |
| Wikipedia | Suberic acid |
| ChEBI | CHEBI:9300 |
| LipidsMAPs | LMFA01170001 |
| ChEMBL | CHEMBL1162491 |
| HMDb | HMDB00893 |
| ChemIDPlus | 000505486; 068937724 |
| KEGG | C08278 |