Systematic / IUPAC Name: (5S)-2-Methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one
ID: Reference13930
Other Names:
(S)-Carvone;
(+)-Carvone;
AA-4554
Formula: C10H14O
Class: Endogenous Metabolites
(+)-(S)-Carvone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 600 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/29/2026 8:55:05 AM |
| InChI | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3/t9-/m0/s1 |
| InChI Key | ULDHMXUKGWMISQ-VIFPVBQESA-N |
| Canonical SMILES | C=C(C)[C@H]1CC=C(C)C(=O)C1 |
| CAS | |
| Splash | |
| Other Names |
(S)-Carvone; (+)-Carvone; AA-4554 |
| HMDb | HMDB0061788; HMDB0035089; HMDB04487 |
| ChEMBL | CHEMBL501949 |
| ChEBI | CHEBI:15399 |
| ChemSpider | More details; 15855 |
| KEGG | C11383 |
| Wikipedia | Carvone |
| PubChem | 16724; 16724 |