Systematic / IUPAC Name: 4-Ethyloctanoic acid
ID: Reference13931
Other Names: AA-4555
Formula: C10H20O2
Class: Endogenous Metabolites
4-Ethyloctanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 275 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/29/2026 8:57:06 AM |
| InChI | InChI=1S/C10H20O2/c1-3-5-6-9(4-2)7-8-10(11)12/h9H,3-8H2,1-2H3,(H,11,12) |
| InChI Key | PWKJMPFEQOHBAC-UHFFFAOYSA-N |
| Canonical SMILES | CCCCC(CC)CCC(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-4555 |
| LipidsMAPs | LMFA01030983 |
| ChEMBL | CHEMBL1789171 |
| ChemSpider | 55713 |
| PubChem | 61840; 61840 |
| HMDb | HMDB0036136 |