Systematic / IUPAC Name: 1-(Furan-2-ylmethyl)pyrrole
ID: Reference13932
Other Names: AA-4556
Formula: C9H9NO
Class: Endogenous Metabolites
1-Furfurylpyrrole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 170 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/29/2026 8:59:37 AM |
| InChI | InChI=1S/C9H9NO/c1-2-6-10(5-1)8-9-4-3-7-11-9/h1-7H,8H2 |
| InChI Key | BTBFUBUCCJKJOZ-UHFFFAOYSA-N |
| Canonical SMILES | c1coc(Cn2cccc2)c1 |
| CAS | |
| Splash | |
| Other Names | AA-4556 |
| ChEMBL | CHEMBL3187231 |
| PubChem | 15037; 15037 |
| HMDb | HMDB30204 |
| ChemSpider | 14312 |