Systematic / IUPAC Name: Ethyl 2-methyl-3-oxobutanoate
ID: Reference13933
Other Names: AA-4570
Formula: C7H12O3
Class: Endogenous Metabolites
Ethyl 2-methylacetoacetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 360 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/29/2026 9:02:14 AM |
| InChI | InChI=1S/C7H12O3/c1-4-10-7(9)5(2)6(3)8/h5H,4H2,1-3H3 |
| InChI Key | FNENWZWNOPCZGK-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C(C)C(C)=O |
| CAS | |
| Splash | |
| Other Names | AA-4570 |
| ChEMBL | CHEMBL31596 |
| PubChem | 701; 701 |
| ChemSpider | CAM-FJL-MDW-53; 21106586 |