Systematic / IUPAC Name: Dimethyl (Z)-but-2-enedioate
ID: Reference13934
Other Names: AA-4572
Formula: C6H8O4
Class: Endogenous Metabolites
Dimethyl maleate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 255 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/29/2026 9:04:02 AM |
| InChI | InChI=1S/C6H8O4/c1-9-5(7)3-4-6(8)10-2/h3-4H,1-2H3/b4-3- |
| InChI Key | LDCRTTXIJACKKU-ARJAWSKDSA-N |
| Canonical SMILES | COC(=O)/C=C\C(=O)OC |
| CAS | |
| Splash | |
| Other Names | AA-4572 |
| ChEBI | CHEBI:35460 |
| HMDb | HMDB0031257 |
| PubChem | 5271565; 5271565 |
| ChemSpider | More details; 4436352 |
| Wikipedia | Dimethyl maleate |
| ChEMBL | CHEMBL2259700 |