Systematic / IUPAC Name: 2-Ethylbutanoic acid
ID: Reference13936
Other Names:
Diethylacetic acid;
AA-4584
Formula: C6H12O2
Class: Endogenous Metabolites
2-Ethylbutyric acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 60 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/29/2026 9:13:11 AM |
| InChI | InChI=1S/C6H12O2/c1-3-5(4-2)6(7)8/h5H,3-4H2,1-2H3,(H,7,8) |
| InChI Key | OXQGTIUCKGYOAA-UHFFFAOYSA-N |
| Canonical SMILES | CCC(CC)C(=O)O |
| CAS | |
| Splash | |
| Other Names |
Diethylacetic acid; AA-4584 |
| PubChem | 6915; 6915 |
| LipidsMAPs | LMFA01020077 |
| HMDb | HMDB0031221 |
| ChEMBL | CHEMBL184290 |
| ChemSpider | 6649 |