Systematic / IUPAC Name: 2-Methylhexanoic acid
ID: Reference13937
Other Names:
2-Methylcaproic acid;
AA-4589
Formula: C7H14O2
Class: Endogenous Metabolites
2-Methylhexanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 130 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/29/2026 9:16:00 AM |
| InChI | InChI=1S/C7H14O2/c1-3-4-5-6(2)7(8)9/h6H,3-5H2,1-2H3,(H,8,9) |
| InChI Key | CVKMFSAVYPAZTQ-UHFFFAOYSA-N |
| Canonical SMILES | CCCCC(C)C(=O)O |
| CAS | |
| Splash | |
| Other Names |
2-Methylcaproic acid; AA-4589 |
| ChEMBL | CHEMBL1789229 |
| PubChem | 20653; 20653 |
| LipidsMAPs | LMFA01020080 |
| HMDb | HMDB0031594 |
| ChemSpider | 19450 |