Systematic / IUPAC Name: 4-Methyloctanoic acid
ID: Reference13938
Other Names:
4-Methylcaprylic acid;
AA-4590
Formula: C9H18O2
Class: Endogenous Metabolites
4-Methyloctanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 77 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/29/2026 9:20:35 AM |
| InChI | InChI=1S/C9H18O2/c1-3-4-5-8(2)6-7-9(10)11/h8H,3-7H2,1-2H3,(H,10,11) |
| InChI Key | LEGGANXCVQPIAI-UHFFFAOYSA-N |
| Canonical SMILES | CCCCC(C)CCC(=O)O |
| CAS | |
| Splash | |
| Other Names |
4-Methylcaprylic acid; AA-4590 |
| PubChem | 62089; 62089 |
| HMDb | HMDB0031557 |
| LipidsMAPs | LMFA01020244 |
| ChemSpider | 55926 |