Systematic / IUPAC Name: (2S)-2-Amino-5-(ethylamino)-5-oxopentanoic acid
ID: Reference13939
Other Names: AA-4427
Formula: C7H14N2O3
Class: Endogenous Metabolites
L-Theanine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 4 |
| No. of Spectra | 1475 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/8/2026 10:41:46 AM |
| InChI | InChI=1S/C7H14N2O3/c1-2-9-6(10)4-3-5(8)7(11)12/h5H,2-4,8H2,1H3,(H,9,10)(H,11,12)/t5-/m0/s1 |
| InChI Key | DATAGRPVKZEWHA-YFKPBYRVSA-N |
| Canonical SMILES | CCNC(=O)CC[C@H](N)C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-4427 |
| HMDb | HMDB0034365; HMDB0034365 |
| ChemSpider | 388498 |
| Wikipedia | Theanine |
| ChEMBL | CHEMBL3039113 |
| KEGG | C01047 |
| PubChem | 25201220; 439378 |
| DrugBank | DB12444 |
| ChEBI | CHEBI:58128 |