Systematic / IUPAC Name: (3S)-3-Hydroxydodecanoic acid
ID: Reference13943
Other Names:
3-Hydroxydodecanoic acid, (3S)-;
AA-2599
Formula: C12H24O3
Class: Endogenous Metabolites
(S)-3-Hydroxylauric acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 130 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/8/2026 9:02:32 AM |
| InChI | InChI=1S/C12H24O3/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15)/t11-/m0/s1 |
| InChI Key | MUCMKTPAZLSKTL-NSHDSACASA-N |
| Canonical SMILES | CCCCCCCCC[C@H](O)CC(=O)O |
| CAS | |
| Splash | |
| Other Names |
3-Hydroxydodecanoic acid, (3S)-; AA-2599 |
| LipidsMAPs | LMFA01050252 |
| ChEBI | CHEBI:36210 |
| ChemSpider | 4472230 |
| PubChem | 5312805 |